HISTOIRE GEOLOGIQUE DU

GEOLOGICAL HISTORY OF

MORVAN

STRUCTURES CRISTALLINES / CRYSTAL STRUCTURES

[REF], [REF]

SILICATES / SILICATES

Tétraèdres isolés / Ortho & rings silicates

GROUPE DE L'OLIVINE/OLIVINE GROUP

crystal structure Olivine/Olivine (Mg,Fe)2[SiO4] Orthorhombique/Orthorhombic
crystal structure Zircon/Zircon Zr[SiO]4 Quadratique / Tetragonal
crystal structure Sphène/Titanite CaTi[SiO4] (O,OH,F) Monoclinique/Monoclinic
crystal structure Sillimanite/Sillimanite Al2 SiO5 Orthorhombique/Orthorhombic
crystal structure Andalousite/Andalusite Al2 SiO5 Orthorhombique/Orthorhombic
crystal structure Topaze/Topaze Al2[SiO4] (OH,F)2 Orthorhombique/Orthorhombic

GROUPE DU GRENAT/GARNET GROUP

crystal structure Almandin/Almandine (Fe+2)3 Al2 Si3O12 Cubique/Cubic
crystal structure Grossulaire/Grossular Ca3 Al2 Si3O12 Cubique/Cubic
crystal structure Pyrope/Pyrope Mg3 Al2 Si3O12 Cubique/Cubic
crystal structure Spessartine/Spessartine Mn3 Al2 Si3O12 Cubique/Cubic

GROUPE DE L'EPIDOTE/EPIDOTE GROUP

crystal structure Epidote/Epidote CaFe+2Al2O.OH[Si2O7][SiO4] Monoclinique/Monoclinic
crystal structure Béryl/Beryl Be3Al2[Si6O18] Hexagonal/Hexagonal
crystal structure Cordiérite/Cordierite Al3(Mg,Fe+2)2[Si5AlO18] Orthorhombique/Orthorhombic
crystal structure Tourmaline/Tourmaline Na(Mg,Fe,Mn,Li,Al)3Al6[Si6O18] (BO3)3 (OH,F)4 Rhomboédrique/Trigonal

Tétraèdres en chaînes / Chain silicates

CLINOPYROXENES/CLINOPYROXENES

crystal structure Diopside/Diopside Ca(Mg,Fe+2,Mn)[Si2O6] Monoclinique/Monoclinic
crystal structure Augite/Augite (Ca,Na,Mg,Fe+2,Mn,Fe+3,Al,Ti)2[(SiAl)2O6] Monoclinique/Monoclinic

AMPHIBOLES/AMPHIBOLES

crystal structure Actinote/Actinolite Ca2(Mg,Fe+2)5[Si8O22](OH,F)2 Monoclinique/Monoclinic
crystal structure Hornblende/Hornblende (Na,K)0-1Ca2(Mg,Fe+2,Fe+3,Al)5[Si6-7Al2-1O22](OH,F)2 Monoclinique/Monoclinic

Tétraèdres en feuillets / Sheets silicates

MICAS/MICAS

crystal structure Biotite/Biotite K2(Mg,Fe+2)6-4(Fe+3,Al,Ti)0-2[Si6-5Al2-3O20](OH,F)4 Monoclinique/Monoclinic
crystal structure Muscovite/Muscovite K2Al4[Si6Al2O20](OH,F)4 Monoclinique/Monoclinic
crystal structure Phlogopite/Phlogopite K2(Mg,Fe+2)6[Si6Al2O20](OH,F)4 Monoclinique/Monoclinic
crystal structure Lépidolite/Lepidolite K2(Li,Al)5-6[Si6-7Al2-1O20](OH,F)4 Monoclinique/Monoclinic
crystal structure Chlorite/Chlorite (Mg,Al,Fe)12[(Si,Al)8O20](OH)16 Monoclinique/Monoclinic
crystal structure Talc/Talc Mg6[Si8O20](OH)4 Monoclinique/Monoclinic
crystal structure Serpentine/Serpentine Mg6[Si8O20](OH)4 Monoclinique/Monoclinic
crystal structure

Pyrophyllite/Pyrophyllite Al4[Si8O20](OH)4 Monoclinique/Monoclinic

ARGILES/CLAYS

Kaolinite Kaolinite/Kaolinite Al4[Si4O10](OH)8 Monoclinique/Monoclinic
Phengite Phengite/Phengite K2Al4-x(Mg,Fe+2)x[Si6+xAl2-xO20](OH)4 Monoclinique/Monoclinic

Tétraèdres en réseau / Frameworks silicates

FELDSPATHS / FELDSPARS

Feldspaths alcalins/Alkali feldspars

Adulaire/Adularia Adulaire/Adularia (K,Na)[AlSi3O8] Monoclinique/Monoclinic
crystal structure Orthose/Orthoclase (K,Na)[AlSi3O8] Monoclinique/Monoclinic
crystal structure Microcline/Microcline (K,Na)[AlSi3O8] Triclinique/Triclinic
   

Plagioclases/Plagioclases

Albite Albite/Albite Na[AlSi3O8] Triclinique/Triclinic
crystal structure Andésine/Andesine (Na,Ca)[AlSi3O8] Triclinique/Triclinic
crystal structure Labrador/Labradorite (Na,Ca)[AlSi3O8] Triclinique/Triclinic
Anorthite Anorthite/Anorthite Ca[Al2Si2O8] Triclinique/Triclinic

OXYDES / OXIDES

Quartz Quartz/Quartz SiO2 Rhomboédrique/Trigonal
Rutile Rutile/Rutile TiO2 Quadratique/Tetragonal
Uraninite Uraninite/Uraninite UO2 Cubique/Cubic
Cassitérite/Cassiterite Cassitérite/Cassiterite SnO2 Quadratique / Tetragonal
crystal structure Oligiste/Hematite Fe2O3 Hexagonal/Hexagonal
crystal structure Ilménite/Ilmenite (Fe,Mg,Mn)TiO3 Rhomboédrique/Trigonal
crystal structure Magnétite/Magnetite Fe2O3 .FeO Cubique/Cubic
crystal structure Spinelles/Spinel (Al, Fe+3,Cr)2O3 .(Mg,Fe+2,Zn,Mn)O Cubique/Cubic
crystal structure Chromite/Chromite Cr2O3 .FeO Cubique/Cubic

HYDROXYDES / HYDROXIDES

crystal structure Lépidocrosite/Lepidocrosite FeO.OH Orthorhombique/Orthorhombic
crystal structure Goethite/Goethite H.FeO2 Orthorhombique/Orthorhombic

SULFURES / SULPHIDES

Pyrite Pyrite/Pyrite FeS2 Cubique/Cubic
crystal structure Pyrrhotine/Pyrrhotite Fe7S8-FeS2 Monoclinique/Monoclinic
crystal structure Mispickel/Arsenopyrite FeAs.S Orthorhombique/Orthorhombic
crystal structure Galène/Galena PbS Cubique/Cubic
crystal structure Blende/Sphalerite ZnS Cubique/Cubic
crystal structure Molybdénite/Molybdenite MoS2 Hexagonal/Hexagonal
crystal structure Chalcosine/Chalcosite Cu2S Orthorhombique/Orthorhombic
crystal structure Chalcopyrite/Chalcopyrite CuFeS2 Quadratique / Tetragonal
crystal structure Erubescite/Bornite Cu5FeS4 Cubique/Cubic
Enargite Enargite/Enargite Cu3AsS4 Orthorhombique/Orthorhombic

SULFATES / SULPHATES

crystal structure Barytine/Barite BaSO4 Orthorhombique/Orthorhombic
crystal structure Célestine/Celestite SrSO4 Orthorhombique/Orthorhombic
crystal structure Anglésite/Anglesite PbSO4 Orthorhombique/Orthorhombic
crystal structure Gypse/Gypsum CaSO4 2H2O Monoclinique/Monoclinic

CARBONATES/CARBONATES

Calcite Calcite/Calcite CaCO3 Rhomboédrique/Trigonal
crystal structure Aragonite/Aragonite CaCO3 Orthorhombique/Orthorhombic
crystal structure Dolomie/Dolomite CaMg (CO3)2 Rhomboédrique/Trigonal
crystal structure Magnésite/Magnesite MgCO3 Rhomboédrique/Trigonal
crystal structure Azurite/Azurite Cu3(OH)2(CO3)2 Monoclinique/Monoclinic
crystal structure Malachite/Malachite Cu2(OH)2.CO3 Monoclinique/Monoclinic
crystal structure Cérusite/Cerusite PbCO3 Orthorhombique/Orthorhombic
crystal structure Smithsonite/Smithsonite ZnCO3 Rhomboédrique/Trigonal

PHOSPHATES/PHOSPHATES

crystal structure Apatite/Apatite Ca5(PO4)3(OH,F,Cl) Hexagonal/Hexagonal
crystal structure Pyromorphite/Mimetite 3((P2As2)O5.3PbO).PbCl2 Hexagonal/Hexagonal
crystal structure Autunite/Autunite Ca(UO2)2.(PO4)2.10-12 H2O Quadratique/Tetragonal
crystal structure Monazite/Monazite (Ce,La,Th)PO4 Monoclinique/Monoclinic

DIVERS/MISCELLANEOUS

crystal structure Wolframite/Wolframite WO3(Fe,Mn)O Monoclinique/Monoclinic
crystal structure Schéelite/Scheelite WO3CaO Quadratique/Tetragonal
crystal structure Wulfénite/Wulfenite MoO3PbO Quadratique/Tetragonal
crystal structure Pyrolusite/Pyrolusite MnO2 Orthorhombique/Orthorhombic

HALIDES/HALIDES

crystal structure Fluorine/Fluorite CaF2 Cubique/Cubic
crystal structure Sel gemme/Halite NaCl Cubique/Cubic

 

SommaireSommaire

ACCUEILACCUEIL/HOMEHOME